C9H14N6O3 — CID 154415679
2-[[(4,6-diamino-1,3,5-triazin-2-yl)amino]methoxy]ethyl prop-2-enoate (PubChem CID 154415679) has the molecular formula C9H14N6O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is 2-[[(4,6-diamino-1,3,5-triazin-2-yl)amino]methoxy]ethyl prop-2-enoate.
| Compound Name | 2-[[(4,6-diamino-1,3,5-triazin-2-yl)amino]methoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 154415679 |
| Molecular Formula | C9H14N6O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-[[(4,6-diamino-1,3,5-triazin-2-yl)amino]methoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCNc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C9H14N6O3/c1-2-6(16)18-4-3-17-5-12-9-14-7(10)13-8(11)15-9/h2H,1,3-5H2,(H5,10,11,12,13,14,15) |
| InChIKey | OHHVKQMWFKUREU-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 138.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|