C6H11N6O5P — CID 174636064
phosphono prop-2-enoate;1,3,5-triazine-2,4,6-triamine (PubChem CID 174636064) has the molecular formula C6H11N6O5P and a molecular weight of 278.17 g/mol. Its IUPAC name is phosphono prop-2-enoate;1,3,5-triazine-2,4,6-triamine.
| Compound Name | phosphono prop-2-enoate;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 174636064 |
| Molecular Formula | C6H11N6O5P |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | phosphono prop-2-enoate;1,3,5-triazine-2,4,6-triamine |
| SMILES | C=CC(=O)OP(=O)(O)O.Nc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C3H6N6.C3H5O5P/c4-1-7-2(5)9-3(6)8-1;1-2-3(4)8-9(5,6)7/h(H6,4,5,6,7,8,9);2H,1H2,(H2,5,6,7) |
| InChIKey | QTHVXDOBZFBACW-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 200.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|