C11H13O7P — CID 89183902
[hydroxy-(4-methyl-3,5-dioxohepta-1,6-dien-4-yl)oxyphosphoryl] prop-2-enoate (PubChem CID 89183902) has the molecular formula C11H13O7P and a molecular weight of 288.19 g/mol. Its IUPAC name is [hydroxy-(4-methyl-3,5-dioxohepta-1,6-dien-4-yl)oxyphosphoryl] prop-2-enoate.
| Compound Name | [hydroxy-(4-methyl-3,5-dioxohepta-1,6-dien-4-yl)oxyphosphoryl] prop-2-enoate |
|---|---|
| PubChem CID | 89183902 |
| Molecular Formula | C11H13O7P |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | [hydroxy-(4-methyl-3,5-dioxohepta-1,6-dien-4-yl)oxyphosphoryl] prop-2-enoate |
| SMILES | C=CC(=O)OP(=O)(O)OC(C)(C(=O)C=C)C(=O)C=C |
| InChI | InChI=1S/C11H13O7P/c1-5-8(12)11(4,9(13)6-2)18-19(15,16)17-10(14)7-3/h5-7H,1-3H2,4H3,(H,15,16) |
| InChIKey | WTXFLTYNSBRNPM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|