C9H15O8P — CID 174553510
2-hydroxypropyl prop-2-enoate;phosphono prop-2-enoate (PubChem CID 174553510) has the molecular formula C9H15O8P and a molecular weight of 282.19 g/mol. Its IUPAC name is 2-hydroxypropyl prop-2-enoate;phosphono prop-2-enoate.
| Compound Name | 2-hydroxypropyl prop-2-enoate;phosphono prop-2-enoate |
|---|---|
| PubChem CID | 174553510 |
| Molecular Formula | C9H15O8P |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-hydroxypropyl prop-2-enoate;phosphono prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)O.C=CC(=O)OP(=O)(O)O |
| InChI | InChI=1S/C6H10O3.C3H5O5P/c1-3-6(8)9-4-5(2)7;1-2-3(4)8-9(5,6)7/h3,5,7H,1,4H2,2H3;2H,1H2,(H2,5,6,7) |
| InChIKey | NIXSXZWIXDUBTL-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|