C6H8N6O — CID 22235146
N-(4,6-diamino-1,3,5-triazin-2-yl)prop-2-enamide (PubChem CID 22235146) has the molecular formula C6H8N6O and a molecular weight of 180.17 g/mol. Its IUPAC name is N-(4,6-diamino-1,3,5-triazin-2-yl)prop-2-enamide.
| Compound Name | N-(4,6-diamino-1,3,5-triazin-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 22235146 |
| Molecular Formula | C6H8N6O |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | N-(4,6-diamino-1,3,5-triazin-2-yl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C6H8N6O/c1-2-3(13)9-6-11-4(7)10-5(8)12-6/h2H,1H2,(H5,7,8,9,10,11,12,13) |
| InChIKey | DHQIYHHEPUYAAX-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|