C13H17N9O3 — CID 57159827
N-[[(4,6-diamino-1,3,5-triazin-2-yl)amino]-bis(prop-2-enoylamino)methyl]prop-2-enamide (PubChem CID 57159827) has the molecular formula C13H17N9O3 and a molecular weight of 347.34 g/mol. Its IUPAC name is N-[[(4,6-diamino-1,3,5-triazin-2-yl)amino]-bis(prop-2-enoylamino)methyl]prop-2-enamide.
| Compound Name | N-[[(4,6-diamino-1,3,5-triazin-2-yl)amino]-bis(prop-2-enoylamino)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 57159827 |
| Molecular Formula | C13H17N9O3 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-[[(4,6-diamino-1,3,5-triazin-2-yl)amino]-bis(prop-2-enoylamino)methyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(NC(=O)C=C)(NC(=O)C=C)Nc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C13H17N9O3/c1-4-7(23)19-13(20-8(24)5-2,21-9(25)6-3)22-12-17-10(14)16-11(15)18-12/h4-6H,1-3H2,(H,19,23)(H,20,24)(H,21,25)(H5,14,15,16,17,18,22) |
| InChIKey | SNXGXJPQABRHKH-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 190.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|