C11H9Cl4N5 — CID 63549392
6-chloro-2-N,2-N-dimethyl-4-N-(2,4,5-trichlorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 63549392) has the molecular formula C11H9Cl4N5 and a molecular weight of 353.04 g/mol. Its IUPAC name is 6-chloro-2-N,2-N-dimethyl-4-N-(2,4,5-trichlorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,2-N-dimethyl-4-N-(2,4,5-trichlorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 63549392 |
| Molecular Formula | C11H9Cl4N5 |
| Molecular Weight | 353.04 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | 6-chloro-2-N,2-N-dimethyl-4-N-(2,4,5-trichlorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(Cl)nc(Nc2cc(Cl)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C11H9Cl4N5/c1-20(2)11-18-9(15)17-10(19-11)16-8-4-6(13)5(12)3-7(8)14/h3-4H,1-2H3,(H,16,17,18,19) |
| InChIKey | GOFISVMXQUBKQF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.04 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|