C12H14ClIN6 — CID 107604708
4-N-(2-chloro-4-iodophenyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 107604708) has the molecular formula C12H14ClIN6 and a molecular weight of 404.64 g/mol. Its IUPAC name is 4-N-(2-chloro-4-iodophenyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(2-chloro-4-iodophenyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 107604708 |
| Molecular Formula | C12H14ClIN6 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | 4-N-(2-chloro-4-iodophenyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(Nc2ccc(I)cc2Cl)nc(N(C)C)n1 |
| InChI | InChI=1S/C12H14ClIN6/c1-15-10-17-11(19-12(18-10)20(2)3)16-9-5-4-7(14)6-8(9)13/h4-6H,1-3H3,(H2,15,16,17,18,19) |
| InChIKey | ZDNIJXOGDGRGIJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|