C11H12ClIN2S — CID 107607269
N-(2-chloro-4-iodophenyl)-5-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 107607269) has the molecular formula C11H12ClIN2S and a molecular weight of 366.66 g/mol. Its IUPAC name is N-(2-chloro-4-iodophenyl)-5-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | N-(2-chloro-4-iodophenyl)-5-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 107607269 |
| Molecular Formula | C11H12ClIN2S |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | N-(2-chloro-4-iodophenyl)-5-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | CC1CN=C(Nc2ccc(I)cc2Cl)SC1 |
| InChI | InChI=1S/C11H12ClIN2S/c1-7-5-14-11(16-6-7)15-10-3-2-8(13)4-9(10)12/h2-4,7H,5-6H2,1H3,(H,14,15) |
| InChIKey | RPCPJDTWSGWWFN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|