C12H15N3OS — CID 114003567
3-[(5-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzamide (PubChem CID 114003567) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is 3-[(5-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzamide.
| Compound Name | 3-[(5-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 114003567 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 3-[(5-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]benzamide |
| SMILES | CC1CN=C(Nc2cccc(C(N)=O)c2)SC1 |
| InChI | InChI=1S/C12H15N3OS/c1-8-6-14-12(17-7-8)15-10-4-2-3-9(5-10)11(13)16/h2-5,8H,6-7H2,1H3,(H2,13,16)(H,14,15) |
| InChIKey | VMBUUKNUQKSLGJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |