C14H19BrN6 — CID 80828707
4-N-(4-bromo-2,6-dimethylphenyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80828707) has the molecular formula C14H19BrN6 and a molecular weight of 351.25 g/mol. Its IUPAC name is 4-N-(4-bromo-2,6-dimethylphenyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(4-bromo-2,6-dimethylphenyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80828707 |
| Molecular Formula | C14H19BrN6 |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 4-N-(4-bromo-2,6-dimethylphenyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(Nc2c(C)cc(Br)cc2C)nc(N(C)C)n1 |
| InChI | InChI=1S/C14H19BrN6/c1-8-6-10(15)7-9(2)11(8)17-13-18-12(16-3)19-14(20-13)21(4)5/h6-7H,1-5H3,(H2,16,17,18,19,20) |
| InChIKey | MISOANYMXQIHNU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |