C7H9Cl2N5S — CID 3032476
1-(4,6-dichloro-1,3,5-triazin-2-yl)-3-propan-2-ylthiourea (PubChem CID 3032476) has the molecular formula C7H9Cl2N5S and a molecular weight of 266.16 g/mol. Its IUPAC name is 1-(4,6-dichloro-1,3,5-triazin-2-yl)-3-propan-2-ylthiourea.
| Compound Name | 1-(4,6-dichloro-1,3,5-triazin-2-yl)-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 3032476 |
| Molecular Formula | C7H9Cl2N5S |
| Molecular Weight | 266.16 g/mol |
| Exact Mass | 265.00 |
| IUPAC Name | 1-(4,6-dichloro-1,3,5-triazin-2-yl)-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)Nc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C7H9Cl2N5S/c1-3(2)10-7(15)14-6-12-4(8)11-5(9)13-6/h3H,1-2H3,(H2,10,11,12,13,14,15) |
| InChIKey | WMZBYVHRZWRMAN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.16 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|