C10H17ClN6S — CID 71444419
1-butyl-3-[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]thiourea (PubChem CID 71444419) has the molecular formula C10H17ClN6S and a molecular weight of 288.81 g/mol. Its IUPAC name is 1-butyl-3-[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]thiourea.
| Compound Name | 1-butyl-3-[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]thiourea |
|---|---|
| PubChem CID | 71444419 |
| Molecular Formula | C10H17ClN6S |
| Molecular Weight | 288.81 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-butyl-3-[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]thiourea |
| SMILES | CCCCNC(=S)Nc1nc(Cl)nc(N(C)C)n1 |
| InChI | InChI=1S/C10H17ClN6S/c1-4-5-6-12-10(18)16-8-13-7(11)14-9(15-8)17(2)3/h4-6H2,1-3H3,(H2,12,13,14,15,16,18) |
| InChIKey | MPMUWKNJWAVAPR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.81 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|