C8H13ClN6S — CID 71444417
1-[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-ethylthiourea (PubChem CID 71444417) has the molecular formula C8H13ClN6S and a molecular weight of 260.75 g/mol. Its IUPAC name is 1-[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-ethylthiourea.
| Compound Name | 1-[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-ethylthiourea |
|---|---|
| PubChem CID | 71444417 |
| Molecular Formula | C8H13ClN6S |
| Molecular Weight | 260.75 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 1-[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-ethylthiourea |
| SMILES | CCNC(=S)Nc1nc(Cl)nc(N(C)C)n1 |
| InChI | InChI=1S/C8H13ClN6S/c1-4-10-8(16)14-6-11-5(9)12-7(13-6)15(2)3/h4H2,1-3H3,(H2,10,11,12,13,14,16) |
| InChIKey | JBUVAZADXLOWDT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.75 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|