C10H18N6OS — CID 71383356
1-[4-ethoxy-6-(ethylamino)-1,3,5-triazin-2-yl]-3-ethylthiourea (PubChem CID 71383356) has the molecular formula C10H18N6OS and a molecular weight of 270.36 g/mol. Its IUPAC name is 1-[4-ethoxy-6-(ethylamino)-1,3,5-triazin-2-yl]-3-ethylthiourea.
| Compound Name | 1-[4-ethoxy-6-(ethylamino)-1,3,5-triazin-2-yl]-3-ethylthiourea |
|---|---|
| PubChem CID | 71383356 |
| Molecular Formula | C10H18N6OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-[4-ethoxy-6-(ethylamino)-1,3,5-triazin-2-yl]-3-ethylthiourea |
| SMILES | CCNC(=S)Nc1nc(NCC)nc(OCC)n1 |
| InChI | InChI=1S/C10H18N6OS/c1-4-11-7-13-8(16-10(18)12-5-2)15-9(14-7)17-6-3/h4-6H2,1-3H3,(H3,11,12,13,14,15,16,18) |
| InChIKey | BMXBGILFVFVFDD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|