C14H25N — CID 170563172
1,5-ditert-butylcyclohexa-2,4-dien-1-amine (PubChem CID 170563172) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 1,5-ditert-butylcyclohexa-2,4-dien-1-amine.
| Compound Name | 1,5-ditert-butylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 170563172 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 1,5-ditert-butylcyclohexa-2,4-dien-1-amine |
| SMILES | CC(C)(C)C1=CC=CC(N)(C(C)(C)C)C1 |
| InChI | InChI=1S/C14H25N/c1-12(2,3)11-8-7-9-14(15,10-11)13(4,5)6/h7-9H,10,15H2,1-6H3 |
| InChIKey | UWDRQDOPDMBPGW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |