C9H14Cl2Zr — CID 175242307
1-tert-butylcyclopenta-1,3-diene;dichlorozirconium (PubChem CID 175242307) has the molecular formula C9H14Cl2Zr and a molecular weight of 284.34 g/mol. Its IUPAC name is 1-tert-butylcyclopenta-1,3-diene;dichlorozirconium.
| Compound Name | 1-tert-butylcyclopenta-1,3-diene;dichlorozirconium |
|---|---|
| PubChem CID | 175242307 |
| Molecular Formula | C9H14Cl2Zr |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 1-tert-butylcyclopenta-1,3-diene;dichlorozirconium |
| SMILES | CC(C)(C)C1=CC=CC1.Cl[Zr]Cl |
| InChI | InChI=1S/C9H14.2ClH.Zr/c1-9(2,3)8-6-4-5-7-8;;;/h4-6H,7H2,1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | XEIRTFMJXGUNDZ-UHFFFAOYSA-L |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |