C12H20O — CID 91497487
3-tert-butylcyclohexa-2,5-dien-1-one;ethane (PubChem CID 91497487) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 3-tert-butylcyclohexa-2,5-dien-1-one;ethane.
| Compound Name | 3-tert-butylcyclohexa-2,5-dien-1-one;ethane |
|---|---|
| PubChem CID | 91497487 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 3-tert-butylcyclohexa-2,5-dien-1-one;ethane |
| SMILES | CC.CC(C)(C)C1=CC(=O)C=CC1 |
| InChI | InChI=1S/C10H14O.C2H6/c1-10(2,3)8-5-4-6-9(11)7-8;1-2/h4,6-7H,5H2,1-3H3;1-2H3 |
| InChIKey | DHSIAQAELDNGSC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |