C15H23N — CID 145194780
1-(4-tert-butylcyclohepta-1,3,6-trien-1-yl)ethenamine;ethene (PubChem CID 145194780) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 1-(4-tert-butylcyclohepta-1,3,6-trien-1-yl)ethenamine;ethene.
| Compound Name | 1-(4-tert-butylcyclohepta-1,3,6-trien-1-yl)ethenamine;ethene |
|---|---|
| PubChem CID | 145194780 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 1-(4-tert-butylcyclohepta-1,3,6-trien-1-yl)ethenamine;ethene |
| SMILES | C=C.C=C(N)C1=CC=C(C(C)(C)C)CC=C1 |
| InChI | InChI=1S/C13H19N.C2H4/c1-10(14)11-6-5-7-12(9-8-11)13(2,3)4;1-2/h5-6,8-9H,1,7,14H2,2-4H3;1-2H2 |
| InChIKey | NWNZNXOYBFNTOL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|