C13H22INO — CID 143092517
ethane;4-[1-(iodoamino)-2-methylpropan-2-yl]cyclohepta-1,3,6-trien-1-ol (PubChem CID 143092517) has the molecular formula C13H22INO and a molecular weight of 335.23 g/mol. Its IUPAC name is ethane;4-[1-(iodoamino)-2-methylpropan-2-yl]cyclohepta-1,3,6-trien-1-ol.
| Compound Name | ethane;4-[1-(iodoamino)-2-methylpropan-2-yl]cyclohepta-1,3,6-trien-1-ol |
|---|---|
| PubChem CID | 143092517 |
| Molecular Formula | C13H22INO |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | ethane;4-[1-(iodoamino)-2-methylpropan-2-yl]cyclohepta-1,3,6-trien-1-ol |
| SMILES | CC.CC(C)(CNI)C1=CC=C(O)C=CC1 |
| InChI | InChI=1S/C11H16INO.C2H6/c1-11(2,8-13-12)9-4-3-5-10(14)7-6-9;1-2/h3,5-7,13-14H,4,8H2,1-2H3;1-2H3 |
| InChIKey | XYGMWBZXFLGSRD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|