C19H21NO — CID 143599748
4-[(2,3,5-trimethylindol-1-yl)methyl]cyclohepta-1,3,6-trien-1-ol (PubChem CID 143599748) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 4-[(2,3,5-trimethylindol-1-yl)methyl]cyclohepta-1,3,6-trien-1-ol.
| Compound Name | 4-[(2,3,5-trimethylindol-1-yl)methyl]cyclohepta-1,3,6-trien-1-ol |
|---|---|
| PubChem CID | 143599748 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 4-[(2,3,5-trimethylindol-1-yl)methyl]cyclohepta-1,3,6-trien-1-ol |
| SMILES | Cc1ccc2c(c1)c(C)c(C)n2CC1=CC=C(O)C=CC1 |
| InChI | InChI=1S/C19H21NO/c1-13-7-10-19-18(11-13)14(2)15(3)20(19)12-16-5-4-6-17(21)9-8-16/h4,6-11,21H,5,12H2,1-3H3 |
| InChIKey | TYFGDPYHMPDBLJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|