C18H27O3P — CID 144822269
ethane;4-[4-(methoxymethyl)phenyl]cyclohepta-1,3,6-trien-1-ol;phosphanylmethanol (PubChem CID 144822269) has the molecular formula C18H27O3P and a molecular weight of 322.39 g/mol. Its IUPAC name is ethane;4-[4-(methoxymethyl)phenyl]cyclohepta-1,3,6-trien-1-ol;phosphanylmethanol.
| Compound Name | ethane;4-[4-(methoxymethyl)phenyl]cyclohepta-1,3,6-trien-1-ol;phosphanylmethanol |
|---|---|
| PubChem CID | 144822269 |
| Molecular Formula | C18H27O3P |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | ethane;4-[4-(methoxymethyl)phenyl]cyclohepta-1,3,6-trien-1-ol;phosphanylmethanol |
| SMILES | CC.COCc1ccc(C2=CC=C(O)C=CC2)cc1.OCP |
| InChI | InChI=1S/C15H16O2.C2H6.CH5OP/c1-17-11-12-5-7-14(8-6-12)13-3-2-4-15(16)10-9-13;1-2;2-1-3/h2,4-10,16H,3,11H2,1H3;1-2H3;2H,1,3H2 |
| InChIKey | MRCWRGNVKZPQOU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|