C8H11NO3 — CID 90693796
N,N-dihydroxy-4-(methoxymethyl)aniline (PubChem CID 90693796) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is N,N-dihydroxy-4-(methoxymethyl)aniline.
| Compound Name | N,N-dihydroxy-4-(methoxymethyl)aniline |
|---|---|
| PubChem CID | 90693796 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | N,N-dihydroxy-4-(methoxymethyl)aniline |
| SMILES | COCc1ccc(N(O)O)cc1 |
| InChI | InChI=1S/C8H11NO3/c1-12-6-7-2-4-8(5-3-7)9(10)11/h2-5,10-11H,6H2,1H3 |
| InChIKey | GBESWBGYWAGDMA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|