C44H44N2O2 — CID 59479623
4-ethyl-N-(4-ethylphenyl)-N-[4-[4-[4-(methoxymethyl)-N-[4-(methoxymethyl)phenyl]anilino]phenyl]phenyl]aniline (PubChem CID 59479623) has the molecular formula C44H44N2O2 and a molecular weight of 632.85 g/mol. Its IUPAC name is 4-ethyl-N-(4-ethylphenyl)-N-[4-[4-[4-(methoxymethyl)-N-[4-(methoxymethyl)phenyl]anilino]phenyl]phenyl]aniline.
| Compound Name | 4-ethyl-N-(4-ethylphenyl)-N-[4-[4-[4-(methoxymethyl)-N-[4-(methoxymethyl)phenyl]anilino]phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 59479623 |
| Molecular Formula | C44H44N2O2 |
| Molecular Weight | 632.85 g/mol |
| Exact Mass | 632.34 |
| IUPAC Name | 4-ethyl-N-(4-ethylphenyl)-N-[4-[4-[4-(methoxymethyl)-N-[4-(methoxymethyl)phenyl]anilino]phenyl]phenyl]aniline |
| SMILES | CCc1ccc(N(c2ccc(CC)cc2)c2ccc(-c3ccc(N(c4ccc(COC)cc4)c4ccc(COC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C44H44N2O2/c1-5-33-7-19-39(20-8-33)45(40-21-9-34(6-2)10-22-40)43-27-15-37(16-28-43)38-17-29-44(30-18-38)46(41-23-11-35(12-24-41)31-47-3)42-25-13-36(14-26-42)32-48-4/h7-30H,5-6,31-32H2,1-4H3 |
| InChIKey | WJVNACOIZWRHKY-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.85 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |