C45H46N2O2 — CID 70846302
N-[4-[4-[N-[4-(ethoxymethyl)phenyl]-4-(methoxymethyl)anilino]phenyl]phenyl]-4-ethyl-N-(4-ethylphenyl)aniline (PubChem CID 70846302) has the molecular formula C45H46N2O2 and a molecular weight of 646.88 g/mol. Its IUPAC name is N-[4-[4-[N-[4-(ethoxymethyl)phenyl]-4-(methoxymethyl)anilino]phenyl]phenyl]-4-ethyl-N-(4-ethylphenyl)aniline.
| Compound Name | N-[4-[4-[N-[4-(ethoxymethyl)phenyl]-4-(methoxymethyl)anilino]phenyl]phenyl]-4-ethyl-N-(4-ethylphenyl)aniline |
|---|---|
| PubChem CID | 70846302 |
| Molecular Formula | C45H46N2O2 |
| Molecular Weight | 646.88 g/mol |
| Exact Mass | 646.36 |
| IUPAC Name | N-[4-[4-[N-[4-(ethoxymethyl)phenyl]-4-(methoxymethyl)anilino]phenyl]phenyl]-4-ethyl-N-(4-ethylphenyl)aniline |
| SMILES | CCOCc1ccc(N(c2ccc(COC)cc2)c2ccc(-c3ccc(N(c4ccc(CC)cc4)c4ccc(CC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C45H46N2O2/c1-5-34-8-20-40(21-9-34)46(41-22-10-35(6-2)11-23-41)44-28-16-38(17-29-44)39-18-30-45(31-19-39)47(42-24-12-36(13-25-42)32-48-4)43-26-14-37(15-27-43)33-49-7-3/h8-31H,5-7,32-33H2,1-4H3 |
| InChIKey | YCAXQXSDPSFZPB-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.88 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |