C10H12O — CID 142851451
1-(4-methylcyclohepta-1,3,6-trien-1-yl)ethanone (PubChem CID 142851451) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is 1-(4-methylcyclohepta-1,3,6-trien-1-yl)ethanone.
| Compound Name | 1-(4-methylcyclohepta-1,3,6-trien-1-yl)ethanone |
|---|---|
| PubChem CID | 142851451 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 1-(4-methylcyclohepta-1,3,6-trien-1-yl)ethanone |
| SMILES | CC(=O)C1=CC=C(C)CC=C1 |
| InChI | InChI=1S/C10H12O/c1-8-4-3-5-10(7-6-8)9(2)11/h3,5-7H,4H2,1-2H3 |
| InChIKey | MHWCNSLMTJUGDB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |