C21H35NO — CID 142137416
ethane;(3Z,5E)-N-methyl-5-(4-methylcyclohepta-1,3,6-trien-1-yl)octa-3,5-dienamide (PubChem CID 142137416) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is ethane;(3Z,5E)-N-methyl-5-(4-methylcyclohepta-1,3,6-trien-1-yl)octa-3,5-dienamide.
| Compound Name | ethane;(3Z,5E)-N-methyl-5-(4-methylcyclohepta-1,3,6-trien-1-yl)octa-3,5-dienamide |
|---|---|
| PubChem CID | 142137416 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | ethane;(3Z,5E)-N-methyl-5-(4-methylcyclohepta-1,3,6-trien-1-yl)octa-3,5-dienamide |
| SMILES | CC.CC.CC/C=C(\C=C/CC(=O)NC)C1=CC=C(C)CC=C1 |
| InChI | InChI=1S/C17H23NO.2C2H6/c1-4-7-15(10-6-11-17(19)18-3)16-9-5-8-14(2)12-13-16;2*1-2/h5-7,9-10,12-13H,4,8,11H2,1-3H3,(H,18,19);2*1-2H3/b10-6-,15-7+;; |
| InChIKey | XQGGSDQYKISZFO-LDTWFEDMSA-N |
| XLogP | 5.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|