C14H19NO — CID 57033478
(5S)-N,5-dimethyl-6-phenylhex-3-enamide (PubChem CID 57033478) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (5S)-N,5-dimethyl-6-phenylhex-3-enamide.
| Compound Name | (5S)-N,5-dimethyl-6-phenylhex-3-enamide |
|---|---|
| PubChem CID | 57033478 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (5S)-N,5-dimethyl-6-phenylhex-3-enamide |
| SMILES | CNC(=O)CC=C[C@@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C14H19NO/c1-12(7-6-10-14(16)15-2)11-13-8-4-3-5-9-13/h3-9,12H,10-11H2,1-2H3,(H,15,16)/t12-/m1/s1 |
| InChIKey | HGIQMCPWNMUCCK-GFCCVEGCSA-N |
| XLogP | 2.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|