C24H36O — CID 123987191
4-(11-methoxy-7,8-dimethyltrideca-2,9,11-trien-3-yl)-1-methylcyclohepta-1,3,5-triene (PubChem CID 123987191) has the molecular formula C24H36O and a molecular weight of 340.55 g/mol. Its IUPAC name is 4-(11-methoxy-7,8-dimethyltrideca-2,9,11-trien-3-yl)-1-methylcyclohepta-1,3,5-triene.
| Compound Name | 4-(11-methoxy-7,8-dimethyltrideca-2,9,11-trien-3-yl)-1-methylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 123987191 |
| Molecular Formula | C24H36O |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | 4-(11-methoxy-7,8-dimethyltrideca-2,9,11-trien-3-yl)-1-methylcyclohepta-1,3,5-triene |
| SMILES | CC=C(C=CC(C)C(C)CCCC(=CC)C1=CC=C(C)CC=C1)OC |
| InChI | InChI=1S/C24H36O/c1-7-22(23-14-9-11-19(3)15-17-23)13-10-12-20(4)21(5)16-18-24(8-2)25-6/h7-9,14-18,20-21H,10-13H2,1-6H3 |
| InChIKey | RMUOCPWOTCNSOX-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|