C21H36F2O — CID 137398084
(3Z)-3,4-difluoro-2-methoxy-6,9,10,13-tetramethyl-5-methylidenepentadeca-1,3-diene (PubChem CID 137398084) has the molecular formula C21H36F2O and a molecular weight of 342.51 g/mol. Its IUPAC name is (3Z)-3,4-difluoro-2-methoxy-6,9,10,13-tetramethyl-5-methylidenepentadeca-1,3-diene.
| Compound Name | (3Z)-3,4-difluoro-2-methoxy-6,9,10,13-tetramethyl-5-methylidenepentadeca-1,3-diene |
|---|---|
| PubChem CID | 137398084 |
| Molecular Formula | C21H36F2O |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | (3Z)-3,4-difluoro-2-methoxy-6,9,10,13-tetramethyl-5-methylidenepentadeca-1,3-diene |
| SMILES | C=C(OC)/C(F)=C(/F)C(=C)C(C)CCC(C)C(C)CCC(C)CC |
| InChI | InChI=1S/C21H36F2O/c1-9-14(2)10-11-15(3)16(4)12-13-17(5)18(6)20(22)21(23)19(7)24-8/h14-17H,6-7,9-13H2,1-5,8H3/b21-20- |
| InChIKey | VRQFPTBCHHDQQU-MRCUWXFGSA-N |
| XLogP | 7.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|