C17H25N — CID 138463349
(1E,3E,4Z)-1-cyclopenta-1,3-dien-1-yl-N,2-dimethyl-3-propylidenehepta-1,4-dien-1-amine (PubChem CID 138463349) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is (1E,3E,4Z)-1-cyclopenta-1,3-dien-1-yl-N,2-dimethyl-3-propylidenehepta-1,4-dien-1-amine.
| Compound Name | (1E,3E,4Z)-1-cyclopenta-1,3-dien-1-yl-N,2-dimethyl-3-propylidenehepta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 138463349 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | (1E,3E,4Z)-1-cyclopenta-1,3-dien-1-yl-N,2-dimethyl-3-propylidenehepta-1,4-dien-1-amine |
| SMILES | CC/C=C\C(=C/CC)\C(C)=C(\NC)C1=CC=CC1 |
| InChI | InChI=1S/C17H25N/c1-5-7-11-15(10-6-2)14(3)17(18-4)16-12-8-9-13-16/h7-12,18H,5-6,13H2,1-4H3/b11-7-,15-10+,17-14+ |
| InChIKey | JDERHNYQZOCFAS-YILANPBWSA-N |
| XLogP | 4.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|