C12H10O2 — CID 123601552
1,2-di(cyclopenta-1,3-dien-1-yl)ethane-1,2-dione (PubChem CID 123601552) has the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1,2-di(cyclopenta-1,3-dien-1-yl)ethane-1,2-dione.
| Compound Name | 1,2-di(cyclopenta-1,3-dien-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 123601552 |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 1,2-di(cyclopenta-1,3-dien-1-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)C1=CC=CC1)C1=CC=CC1 |
| InChI | InChI=1S/C12H10O2/c13-11(9-5-1-2-6-9)12(14)10-7-3-4-8-10/h1-5,7H,6,8H2 |
| InChIKey | XQXUKSIHEBSNNN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|