2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid

C14H14O2 — CID 54527252

IUPAC2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid
SMILESCC(C1=CC=CC1)=C(C(=O)O)C1=CC=CC1
InChIInChI=1S/C14H14O2/c1-10(11-6-2-3-7-11)13(14(15)16)12-8-4-5-9-12/h2-6,8H,7,9H2,1H3,(H,15,16)
InChIKeyYTZTVNKJFOKECH-UHFFFAOYSA-N
MW214.26 g/mol
LogP3.16
Rot. Bonds3

About 2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid

2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid (PubChem CID 54527252) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid.

Molecular Properties

Compound Name2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid
PubChem CID54527252
Molecular FormulaC14H14O2
Molecular Weight214.26 g/mol
Exact Mass214.10
IUPAC Name2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid
SMILESCC(C1=CC=CC1)=C(C(=O)O)C1=CC=CC1
InChIInChI=1S/C14H14O2/c1-10(11-6-2-3-7-11)13(14(15)16)12-8-4-5-9-12/h2-6,8H,7,9H2,1H3,(H,15,16)
InChIKeyYTZTVNKJFOKECH-UHFFFAOYSA-N
XLogP3.16
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.26
LogP ≤ 53.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid?
The IUPAC name of 2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid (CID 54527252) is 2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid.
What is the SMILES notation for 2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid?
The canonical SMILES for 2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid is CC(C1=CC=CC1)=C(C(=O)O)C1=CC=CC1.
What is the InChIKey of 2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid?
The InChIKey is YTZTVNKJFOKECH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2/c1-10(11-6-2-3-7-11)13(14(15)16)12-8-4-5-9-12/h2-6,8H,7,9H2,1H3,(H,15,16).
What are the key properties of 2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid?
2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid has a molecular weight of 214.26 g/mol, XLogP of 3.16, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid is sourced from PubChem (CID 54527252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).