C14H14O2 — CID 54527252
2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid (PubChem CID 54527252) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid.
| Compound Name | 2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 54527252 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2,3-di(cyclopenta-1,3-dien-1-yl)but-2-enoic acid |
| SMILES | CC(C1=CC=CC1)=C(C(=O)O)C1=CC=CC1 |
| InChI | InChI=1S/C14H14O2/c1-10(11-6-2-3-7-11)13(14(15)16)12-8-4-5-9-12/h2-6,8H,7,9H2,1H3,(H,15,16) |
| InChIKey | YTZTVNKJFOKECH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|