C7H9NO2 — CID 22887606
N-hydroxy-N-methylcyclopenta-1,3-diene-1-carboxamide (PubChem CID 22887606) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is N-hydroxy-N-methylcyclopenta-1,3-diene-1-carboxamide.
| Compound Name | N-hydroxy-N-methylcyclopenta-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 22887606 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | N-hydroxy-N-methylcyclopenta-1,3-diene-1-carboxamide |
| SMILES | CN(O)C(=O)C1=CC=CC1 |
| InChI | InChI=1S/C7H9NO2/c1-8(10)7(9)6-4-2-3-5-6/h2-4,10H,5H2,1H3 |
| InChIKey | MINAGNPDXRFTFR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|