C12H19NO2 — CID 102277327
N-(6-hydroxyhexyl)cyclopenta-1,3-diene-1-carboxamide (PubChem CID 102277327) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is N-(6-hydroxyhexyl)cyclopenta-1,3-diene-1-carboxamide.
| Compound Name | N-(6-hydroxyhexyl)cyclopenta-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 102277327 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-(6-hydroxyhexyl)cyclopenta-1,3-diene-1-carboxamide |
| SMILES | O=C(NCCCCCCO)C1=CC=CC1 |
| InChI | InChI=1S/C12H19NO2/c14-10-6-2-1-5-9-13-12(15)11-7-3-4-8-11/h3-4,7,14H,1-2,5-6,8-10H2,(H,13,15) |
| InChIKey | KONVSLDXNUWRJA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|