C24H38N4O2 — CID 67923287
1-methyl-N-[10-[(1-methyl-2H-pyridine-3-carbonyl)amino]decyl]-2H-pyridine-3-carboxamide (PubChem CID 67923287) has the molecular formula C24H38N4O2 and a molecular weight of 414.59 g/mol. Its IUPAC name is 1-methyl-N-[10-[(1-methyl-2H-pyridine-3-carbonyl)amino]decyl]-2H-pyridine-3-carboxamide.
| Compound Name | 1-methyl-N-[10-[(1-methyl-2H-pyridine-3-carbonyl)amino]decyl]-2H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67923287 |
| Molecular Formula | C24H38N4O2 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | 1-methyl-N-[10-[(1-methyl-2H-pyridine-3-carbonyl)amino]decyl]-2H-pyridine-3-carboxamide |
| SMILES | CN1C=CC=C(C(=O)NCCCCCCCCCCNC(=O)C2=CC=CN(C)C2)C1 |
| InChI | InChI=1S/C24H38N4O2/c1-27-17-11-13-21(19-27)23(29)25-15-9-7-5-3-4-6-8-10-16-26-24(30)22-14-12-18-28(2)20-22/h11-14,17-18H,3-10,15-16,19-20H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | VTUZUTOWXBHWIU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|