About propyl 1-methyl-2H-pyridine-3-carboxylate;hydrochloride
propyl 1-methyl-2H-pyridine-3-carboxylate;hydrochloride (PubChem CID 67461618) has the molecular formula C10H16ClNO2
and a molecular weight of 217.70 g/mol. Its IUPAC name is propyl 1-methyl-2H-pyridine-3-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | propyl 1-methyl-2H-pyridine-3-carboxylate;hydrochloride |
| PubChem CID | 67461618 |
| Molecular Formula | C10H16ClNO2 |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | propyl 1-methyl-2H-pyridine-3-carboxylate;hydrochloride |
| SMILES | CCCOC(=O)C1=CC=CN(C)C1.Cl |
| InChI | InChI=1S/C10H15NO2.ClH/c1-3-7-13-10(12)9-5-4-6-11(2)8-9;/h4-6H,3,7-8H2,1-2H3;1H |
| InChIKey | IAMZQBQPEHEFTL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propyl 1-methyl-2H-pyridine-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 1-methyl-2H-pyridine-3-carboxylate;hydrochloride?
The IUPAC name of propyl 1-methyl-2H-pyridine-3-carboxylate;hydrochloride (CID 67461618) is propyl 1-methyl-2H-pyridine-3-carboxylate;hydrochloride.
What is the SMILES notation for propyl 1-methyl-2H-pyridine-3-carboxylate;hydrochloride?
The canonical SMILES for propyl 1-methyl-2H-pyridine-3-carboxylate;hydrochloride is CCCOC(=O)C1=CC=CN(C)C1.Cl.
What is the InChIKey of propyl 1-methyl-2H-pyridine-3-carboxylate;hydrochloride?
The InChIKey is IAMZQBQPEHEFTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2.ClH/c1-3-7-13-10(12)9-5-4-6-11(2)8-9;/h4-6H,3,7-8H2,1-2H3;1H.
What are the key properties of propyl 1-methyl-2H-pyridine-3-carboxylate;hydrochloride?
propyl 1-methyl-2H-pyridine-3-carboxylate;hydrochloride has a molecular weight of 217.70 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 1-methyl-2H-pyridine-3-carboxylate;hydrochloride is sourced from PubChem (CID 67461618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).