About propyl 2H-oxete-3-carboxylate
propyl 2H-oxete-3-carboxylate (PubChem CID 54467668) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is propyl 2H-oxete-3-carboxylate.
Molecular Properties
| Compound Name | propyl 2H-oxete-3-carboxylate |
| PubChem CID | 54467668 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | propyl 2H-oxete-3-carboxylate |
| SMILES | CCCOC(=O)C1=COC1 |
| InChI | InChI=1S/C7H10O3/c1-2-3-10-7(8)6-4-9-5-6/h4H,2-3,5H2,1H3 |
| InChIKey | XGBXOZYBTOAQES-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propyl 2H-oxete-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2H-oxete-3-carboxylate?
The IUPAC name of propyl 2H-oxete-3-carboxylate (CID 54467668) is propyl 2H-oxete-3-carboxylate.
What is the SMILES notation for propyl 2H-oxete-3-carboxylate?
The canonical SMILES for propyl 2H-oxete-3-carboxylate is CCCOC(=O)C1=COC1.
What is the InChIKey of propyl 2H-oxete-3-carboxylate?
The InChIKey is XGBXOZYBTOAQES-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-2-3-10-7(8)6-4-9-5-6/h4H,2-3,5H2,1H3.
What are the key properties of propyl 2H-oxete-3-carboxylate?
propyl 2H-oxete-3-carboxylate has a molecular weight of 142.15 g/mol, XLogP of 0.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2H-oxete-3-carboxylate is sourced from PubChem (CID 54467668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).