About propyl (3S)-3-amino-3-methyl-2H-1,2-oxazole-4-carboxylate
propyl (3S)-3-amino-3-methyl-2H-1,2-oxazole-4-carboxylate (PubChem CID 70611900) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is propyl (3S)-3-amino-3-methyl-2H-1,2-oxazole-4-carboxylate.
Analyze propyl (3S)-3-amino-3-methyl-2H-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl (3S)-3-amino-3-methyl-2H-1,2-oxazole-4-carboxylate?
The IUPAC name of propyl (3S)-3-amino-3-methyl-2H-1,2-oxazole-4-carboxylate (CID 70611900) is propyl (3S)-3-amino-3-methyl-2H-1,2-oxazole-4-carboxylate.
What is the SMILES notation for propyl (3S)-3-amino-3-methyl-2H-1,2-oxazole-4-carboxylate?
The canonical SMILES for propyl (3S)-3-amino-3-methyl-2H-1,2-oxazole-4-carboxylate is CCCOC(=O)C1=CON[C@]1(C)N.
What is the InChIKey of propyl (3S)-3-amino-3-methyl-2H-1,2-oxazole-4-carboxylate?
The InChIKey is BNJOXOJGRRLQJM-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H14N2O3/c1-3-4-12-7(11)6-5-13-10-8(6,2)9/h5,10H,3-4,9H2,1-2H3/t8-/m0/s1.
What are the key properties of propyl (3S)-3-amino-3-methyl-2H-1,2-oxazole-4-carboxylate?
propyl (3S)-3-amino-3-methyl-2H-1,2-oxazole-4-carboxylate has a molecular weight of 186.21 g/mol, XLogP of 0.03, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propyl (3S)-3-amino-3-methyl-2H-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 70611900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).