C16H17NO6 — CID 142764912
dipropyl 1,3-dioxoisoindole-5,6-dicarboxylate (PubChem CID 142764912) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is dipropyl 1,3-dioxoisoindole-5,6-dicarboxylate.
| Compound Name | dipropyl 1,3-dioxoisoindole-5,6-dicarboxylate |
|---|---|
| PubChem CID | 142764912 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | dipropyl 1,3-dioxoisoindole-5,6-dicarboxylate |
| SMILES | CCCOC(=O)c1cc2c(cc1C(=O)OCCC)C(=O)NC2=O |
| InChI | InChI=1S/C16H17NO6/c1-3-5-22-15(20)11-7-9-10(14(19)17-13(9)18)8-12(11)16(21)23-6-4-2/h7-8H,3-6H2,1-2H3,(H,17,18,19) |
| InChIKey | ZQKIUIYANISJLS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|