C16H23F6N2O6S2- — CID 158451341
bis(trifluoromethylsulfonyl)azanide;butyl 1-butyl-2H-pyridine-3-carboxylate (PubChem CID 158451341) has the molecular formula C16H23F6N2O6S2- and a molecular weight of 517.49 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;butyl 1-butyl-2H-pyridine-3-carboxylate.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;butyl 1-butyl-2H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 158451341 |
| Molecular Formula | C16H23F6N2O6S2- |
| Molecular Weight | 517.49 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;butyl 1-butyl-2H-pyridine-3-carboxylate |
| SMILES | CCCCOC(=O)C1=CC=CN(CCCC)C1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H23NO2.C2F6NO4S2/c1-3-5-9-15-10-7-8-13(12-15)14(16)17-11-6-4-2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h7-8,10H,3-6,9,11-12H2,1-2H3;/q;-1 |
| InChIKey | HEAIVDJEALEGLM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 111.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|