C9H14F6N3O6S2- — CID 159837046
bis(trifluoromethylsulfonyl)azanide;1,3-diethoxy-2H-imidazole (PubChem CID 159837046) has the molecular formula C9H14F6N3O6S2- and a molecular weight of 438.35 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1,3-diethoxy-2H-imidazole.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1,3-diethoxy-2H-imidazole |
|---|---|
| PubChem CID | 159837046 |
| Molecular Formula | C9H14F6N3O6S2- |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1,3-diethoxy-2H-imidazole |
| SMILES | CCON1C=CN(OCC)C1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H14N2O2.C2F6NO4S2/c1-3-10-8-5-6-9(7-8)11-4-2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-6H,3-4,7H2,1-2H3;/q;-1 |
| InChIKey | NOFFLONXHGHOEU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 107.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |