C8H12N2O2 — CID 142921037
N-(2-hydroxyethyl)-1,2-dihydropyridine-3-carboxamide (PubChem CID 142921037) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-1,2-dihydropyridine-3-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-1,2-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 142921037 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | N-(2-hydroxyethyl)-1,2-dihydropyridine-3-carboxamide |
| SMILES | O=C(NCCO)C1=CC=CNC1 |
| InChI | InChI=1S/C8H12N2O2/c11-5-4-10-8(12)7-2-1-3-9-6-7/h1-3,9,11H,4-6H2,(H,10,12) |
| InChIKey | BAJLHZKIYYQCED-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |