C16H23N3O5 — CID 58035795
1-N,3-N-bis(2-hydroxyethyl)-5-N-propylbenzene-1,3,5-tricarboxamide (PubChem CID 58035795) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is 1-N,3-N-bis(2-hydroxyethyl)-5-N-propylbenzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N-bis(2-hydroxyethyl)-5-N-propylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 58035795 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 1-N,3-N-bis(2-hydroxyethyl)-5-N-propylbenzene-1,3,5-tricarboxamide |
| SMILES | CCCNC(=O)c1cc(C(=O)NCCO)cc(C(=O)NCCO)c1 |
| InChI | InChI=1S/C16H23N3O5/c1-2-3-17-14(22)11-8-12(15(23)18-4-6-20)10-13(9-11)16(24)19-5-7-21/h8-10,20-21H,2-7H2,1H3,(H,17,22)(H,18,23)(H,19,24) |
| InChIKey | IYUSVRAHOGTAGD-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |