C14H20N2O3 — CID 15027317
5-hydroxy-1-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 15027317) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 5-hydroxy-1-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 5-hydroxy-1-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 15027317 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 5-hydroxy-1-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCNC(=O)c1cc(O)cc(C(=O)NCCC)c1 |
| InChI | InChI=1S/C14H20N2O3/c1-3-5-15-13(18)10-7-11(9-12(17)8-10)14(19)16-6-4-2/h7-9,17H,3-6H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | ZJICJNYPPMBUCH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |