C10H12ClNO3 — CID 107705954
N-(3-chloropropyl)-3,5-dihydroxybenzamide (PubChem CID 107705954) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is N-(3-chloropropyl)-3,5-dihydroxybenzamide.
| Compound Name | N-(3-chloropropyl)-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107705954 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | N-(3-chloropropyl)-3,5-dihydroxybenzamide |
| SMILES | O=C(NCCCCl)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C10H12ClNO3/c11-2-1-3-12-10(15)7-4-8(13)6-9(14)5-7/h4-6,13-14H,1-3H2,(H,12,15) |
| InChIKey | DYZJPYAADWSRCF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|