C6H9NO5 — CID 91339514
cyclopenta-1,3-diene-1-carboxylic acid;N-hydroperoxyhydroxylamine (PubChem CID 91339514) has the molecular formula C6H9NO5 and a molecular weight of 175.14 g/mol. Its IUPAC name is cyclopenta-1,3-diene-1-carboxylic acid;N-hydroperoxyhydroxylamine.
| Compound Name | cyclopenta-1,3-diene-1-carboxylic acid;N-hydroperoxyhydroxylamine |
|---|---|
| PubChem CID | 91339514 |
| Molecular Formula | C6H9NO5 |
| Molecular Weight | 175.14 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | cyclopenta-1,3-diene-1-carboxylic acid;N-hydroperoxyhydroxylamine |
| SMILES | O=C(O)C1=CC=CC1.ONOO |
| InChI | InChI=1S/C6H6O2.H3NO3/c7-6(8)5-3-1-2-4-5;2-1-4-3/h1-3H,4H2,(H,7,8);1-3H |
| InChIKey | JIOBXYHGYUHXHW-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.14 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|