About 1-cyclopenta-1,3-dien-1-yl-2-methylsulfanylethanone
1-cyclopenta-1,3-dien-1-yl-2-methylsulfanylethanone (PubChem CID 15514432) has the molecular formula C8H10OS
and a molecular weight of 154.23 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-2-methylsulfanylethanone.
Analyze 1-cyclopenta-1,3-dien-1-yl-2-methylsulfanylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-1,3-dien-1-yl-2-methylsulfanylethanone?
The IUPAC name of 1-cyclopenta-1,3-dien-1-yl-2-methylsulfanylethanone (CID 15514432) is 1-cyclopenta-1,3-dien-1-yl-2-methylsulfanylethanone.
What is the SMILES notation for 1-cyclopenta-1,3-dien-1-yl-2-methylsulfanylethanone?
The canonical SMILES for 1-cyclopenta-1,3-dien-1-yl-2-methylsulfanylethanone is CSCC(=O)C1=CC=CC1.
What is the InChIKey of 1-cyclopenta-1,3-dien-1-yl-2-methylsulfanylethanone?
The InChIKey is XEAOWEHDICRCRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10OS/c1-10-6-8(9)7-4-2-3-5-7/h2-4H,5-6H2,1H3.
What are the key properties of 1-cyclopenta-1,3-dien-1-yl-2-methylsulfanylethanone?
1-cyclopenta-1,3-dien-1-yl-2-methylsulfanylethanone has a molecular weight of 154.23 g/mol, XLogP of 1.80, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-1,3-dien-1-yl-2-methylsulfanylethanone is sourced from PubChem (CID 15514432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).