About 2-[(4-bromophenyl)methylsulfanyl]-1-cyclopenta-1,3-dien-1-ylethanone
2-[(4-bromophenyl)methylsulfanyl]-1-cyclopenta-1,3-dien-1-ylethanone (PubChem CID 15514440) has the molecular formula C14H13BrOS
and a molecular weight of 309.23 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylsulfanyl]-1-cyclopenta-1,3-dien-1-ylethanone.
Molecular Properties
| Compound Name | 2-[(4-bromophenyl)methylsulfanyl]-1-cyclopenta-1,3-dien-1-ylethanone |
| PubChem CID | 15514440 |
| Molecular Formula | C14H13BrOS |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 2-[(4-bromophenyl)methylsulfanyl]-1-cyclopenta-1,3-dien-1-ylethanone |
| SMILES | O=C(CSCc1ccc(Br)cc1)C1=CC=CC1 |
| InChI | InChI=1S/C14H13BrOS/c15-13-7-5-11(6-8-13)9-17-10-14(16)12-3-1-2-4-12/h1-3,5-8H,4,9-10H2 |
| InChIKey | IBCPYPOWRBFDDA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(4-bromophenyl)methylsulfanyl]-1-cyclopenta-1,3-dien-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-bromophenyl)methylsulfanyl]-1-cyclopenta-1,3-dien-1-ylethanone?
The IUPAC name of 2-[(4-bromophenyl)methylsulfanyl]-1-cyclopenta-1,3-dien-1-ylethanone (CID 15514440) is 2-[(4-bromophenyl)methylsulfanyl]-1-cyclopenta-1,3-dien-1-ylethanone.
What is the SMILES notation for 2-[(4-bromophenyl)methylsulfanyl]-1-cyclopenta-1,3-dien-1-ylethanone?
The canonical SMILES for 2-[(4-bromophenyl)methylsulfanyl]-1-cyclopenta-1,3-dien-1-ylethanone is O=C(CSCc1ccc(Br)cc1)C1=CC=CC1.
What is the InChIKey of 2-[(4-bromophenyl)methylsulfanyl]-1-cyclopenta-1,3-dien-1-ylethanone?
The InChIKey is IBCPYPOWRBFDDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrOS/c15-13-7-5-11(6-8-13)9-17-10-14(16)12-3-1-2-4-12/h1-3,5-8H,4,9-10H2.
What are the key properties of 2-[(4-bromophenyl)methylsulfanyl]-1-cyclopenta-1,3-dien-1-ylethanone?
2-[(4-bromophenyl)methylsulfanyl]-1-cyclopenta-1,3-dien-1-ylethanone has a molecular weight of 309.23 g/mol, XLogP of 4.14, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-bromophenyl)methylsulfanyl]-1-cyclopenta-1,3-dien-1-ylethanone is sourced from PubChem (CID 15514440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).