C13H18BrNOS — CID 967739
2-[(4-bromophenyl)methylsulfanyl]-N,N-diethylacetamide (PubChem CID 967739) has the molecular formula C13H18BrNOS and a molecular weight of 316.26 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylsulfanyl]-N,N-diethylacetamide.
| Compound Name | 2-[(4-bromophenyl)methylsulfanyl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 967739 |
| Molecular Formula | C13H18BrNOS |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2-[(4-bromophenyl)methylsulfanyl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CSCc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H18BrNOS/c1-3-15(4-2)13(16)10-17-9-11-5-7-12(14)8-6-11/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | SCGMZNFCUGZMNI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |